C49H42N4O4 — CID 90768996
2,7,12,17-tetrakis(3-methoxyphenyl)-4-methyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11,13,15,17,19-decaene (PubChem CID 90768996) has the molecular formula C49H42N4O4 and a molecular weight of 750.90 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(3-methoxyphenyl)-4-methyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11,13,15,17,19-decaene.
| Compound Name | 2,7,12,17-tetrakis(3-methoxyphenyl)-4-methyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 90768996 |
| Molecular Formula | C49H42N4O4 |
| Molecular Weight | 750.90 g/mol |
| Exact Mass | 750.32 |
| IUPAC Name | 2,7,12,17-tetrakis(3-methoxyphenyl)-4-methyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),5,7,9,11,13,15,17,19-decaene |
| SMILES | COc1cccc(C2=c3ccc([nH]3)=C(c3cccc(OC)c3)c3ccc([nH]3)C(c3cccc(OC)c3)=c3ccc([nH]3)=C(c3cccc(OC)c3)c3cc2cn3C)c1 |
| InChI | InChI=1S/C49H42N4O4/c1-53-29-34-28-45(53)49(33-13-9-17-38(27-33)57-5)44-23-22-43(52-44)48(32-12-8-16-37(26-32)56-4)42-21-20-41(51-42)47(31-11-7-15-36(25-31)55-3)40-19-18-39(50-40)46(34)30-10-6-14-35(24-30)54-2/h6-29,50-52H,1-5H3 |
| InChIKey | KOTOFSKDNIBDEK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.90 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |