C10H10N2OS — CID 25124592
4-(3-methoxyphenyl)-1,3-dihydroimidazole-2-thione (PubChem CID 25124592) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(3-methoxyphenyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 25124592 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-(3-methoxyphenyl)-1,3-dihydroimidazole-2-thione |
| SMILES | COc1cccc(-c2c[nH]c(=S)[nH]2)c1 |
| InChI | InChI=1S/C10H10N2OS/c1-13-8-4-2-3-7(5-8)9-6-11-10(14)12-9/h2-6H,1H3,(H2,11,12,14) |
| InChIKey | NAHCKRAVJDCJKM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|