C10H9NO2S — CID 18439774
5-(3-methoxyphenyl)-3H-1,3-oxazole-2-thione (PubChem CID 18439774) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-3H-1,3-oxazole-2-thione.
| Compound Name | 5-(3-methoxyphenyl)-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 18439774 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 5-(3-methoxyphenyl)-3H-1,3-oxazole-2-thione |
| SMILES | COc1cccc(-c2c[nH]c(=S)o2)c1 |
| InChI | InChI=1S/C10H9NO2S/c1-12-8-4-2-3-7(5-8)9-6-11-10(14)13-9/h2-6H,1H3,(H,11,14) |
| InChIKey | KOTXZVLZQCPXEH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|