C13H14O2 — CID 70996763
5-(3-methoxyphenyl)-2,3-dimethylfuran (PubChem CID 70996763) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-2,3-dimethylfuran.
| Compound Name | 5-(3-methoxyphenyl)-2,3-dimethylfuran |
|---|---|
| PubChem CID | 70996763 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-(3-methoxyphenyl)-2,3-dimethylfuran |
| SMILES | COc1cccc(-c2cc(C)c(C)o2)c1 |
| InChI | InChI=1S/C13H14O2/c1-9-7-13(15-10(9)2)11-5-4-6-12(8-11)14-3/h4-8H,1-3H3 |
| InChIKey | YBYPPCVAYWYCIW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |