C12H14N2O — CID 57246578
5-(3-methoxyphenyl)-1,3-dimethylpyrazole (PubChem CID 57246578) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1,3-dimethylpyrazole.
| Compound Name | 5-(3-methoxyphenyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 57246578 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5-(3-methoxyphenyl)-1,3-dimethylpyrazole |
| SMILES | COc1cccc(-c2cc(C)nn2C)c1 |
| InChI | InChI=1S/C12H14N2O/c1-9-7-12(14(2)13-9)10-5-4-6-11(8-10)15-3/h4-8H,1-3H3 |
| InChIKey | BQFBFMYNTXBXJW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |