C44H40N4O2 — CID 135863003
(9Z,15Z,19Z)-5-tert-butyl-10,20-bis(3-methoxyphenyl)-15-phenyl-5,21,23,24-tetrahydroporphyrin (PubChem CID 135863003) has the molecular formula C44H40N4O2 and a molecular weight of 656.83 g/mol. Its IUPAC name is (9Z,15Z,19Z)-5-tert-butyl-10,20-bis(3-methoxyphenyl)-15-phenyl-5,21,23,24-tetrahydroporphyrin.
| Compound Name | (9Z,15Z,19Z)-5-tert-butyl-10,20-bis(3-methoxyphenyl)-15-phenyl-5,21,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 135863003 |
| Molecular Formula | C44H40N4O2 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | (9Z,15Z,19Z)-5-tert-butyl-10,20-bis(3-methoxyphenyl)-15-phenyl-5,21,23,24-tetrahydroporphyrin |
| SMILES | COc1cccc(/C2=C3\C=CC(=N3)C(C(C)(C)C)c3ccc([nH]3)/C(c3cccc(OC)c3)=c3/cc/c([nH]3)=C(\c3ccccc3)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C44H40N4O2/c1-44(2,3)43-38-23-21-36(47-38)41(28-13-9-15-30(25-28)49-4)34-19-17-32(45-34)40(27-11-7-6-8-12-27)33-18-20-35(46-33)42(37-22-24-39(43)48-37)29-14-10-16-31(26-29)50-5/h6-26,43,45-47H,1-5H3/b40-32-,41-34-,42-37- |
| InChIKey | ZGKVWVWUYPHVEL-LVGHIFEMSA-N |
| XLogP | 8.10 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |