C48H40N4O4 — CID 139253411
(4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20,21,23-tetrahydroporphyrin (PubChem CID 139253411) has the molecular formula C48H40N4O4 and a molecular weight of 736.87 g/mol. Its IUPAC name is (4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20,21,23-tetrahydroporphyrin.
| Compound Name | (4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20,21,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 139253411 |
| Molecular Formula | C48H40N4O4 |
| Molecular Weight | 736.87 g/mol |
| Exact Mass | 736.30 |
| IUPAC Name | (4Z,9Z,15Z)-5,10,15,20-tetrakis(4-methoxyphenyl)-1,20,21,23-tetrahydroporphyrin |
| SMILES | COc1ccc(/C2=C3\C=CC(N3)C(c3ccc(OC)cc3)C3=N/C(=C(/c4ccc(OC)cc4)c4ccc([nH]4)/C(c4ccc(OC)cc4)=C4/C=CC2=N4)C=C3)cc1 |
| InChI | InChI=1S/C48H40N4O4/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31/h5-28,37,45,49,52H,1-4H3/b46-39-,47-40-,48-43- |
| InChIKey | LDGHELPNXRTNGQ-NVWBGVBHSA-N |
| XLogP | 9.33 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.87 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |