C40H30N4 — CID 136832644
(5Z,14Z,19Z)-10,10-dimethyl-5,15,20-triphenyl-21H-porphyrin (PubChem CID 136832644) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is (5Z,14Z,19Z)-10,10-dimethyl-5,15,20-triphenyl-21H-porphyrin.
| Compound Name | (5Z,14Z,19Z)-10,10-dimethyl-5,15,20-triphenyl-21H-porphyrin |
|---|---|
| PubChem CID | 136832644 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (5Z,14Z,19Z)-10,10-dimethyl-5,15,20-triphenyl-21H-porphyrin |
| SMILES | CC1(C)C2=N/C(=C(/c3ccccc3)C3=N/C(=C(/c4ccccc4)c4ccc([nH]4)/C(c4ccccc4)=C4/C=CC1=N4)C=C3)C=C2 |
| InChI | InChI=1S/C40H30N4/c1-40(2)35-24-22-33(43-35)38(27-14-8-4-9-15-27)31-20-18-29(41-31)37(26-12-6-3-7-13-26)30-19-21-32(42-30)39(28-16-10-5-11-17-28)34-23-25-36(40)44-34/h3-25,41H,1-2H3/b37-30-,38-33-,39-34- |
| InChIKey | RXWREMGNEZVFJW-RQOHZYOUSA-N |
| XLogP | 9.02 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |