C48H40N4 — CID 10919474
(10Z,14Z,19Z)-5-butyl-5,10,15,20-tetraphenyl-22,23-dihydro-21H-porphyrin (PubChem CID 10919474) has the molecular formula C48H40N4 and a molecular weight of 672.88 g/mol. Its IUPAC name is (10Z,14Z,19Z)-5-butyl-5,10,15,20-tetraphenyl-22,23-dihydro-21H-porphyrin.
| Compound Name | (10Z,14Z,19Z)-5-butyl-5,10,15,20-tetraphenyl-22,23-dihydro-21H-porphyrin |
|---|---|
| PubChem CID | 10919474 |
| Molecular Formula | C48H40N4 |
| Molecular Weight | 672.88 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | (10Z,14Z,19Z)-5-butyl-5,10,15,20-tetraphenyl-22,23-dihydro-21H-porphyrin |
| SMILES | CCCCC1(c2ccccc2)c2ccc([nH]2)/C(c2ccccc2)=C2/C=CC(=N2)/C(c2ccccc2)=c2/cc/c([nH]2)=C(\c2ccccc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C48H40N4/c1-2-3-32-48(36-22-14-7-15-23-36)43-30-28-41(51-43)46(34-18-10-5-11-19-34)39-26-24-37(49-39)45(33-16-8-4-9-17-33)38-25-27-40(50-38)47(35-20-12-6-13-21-35)42-29-31-44(48)52-42/h4-31,49,51-52H,2-3,32H2,1H3/b45-37-,46-39-,47-40- |
| InChIKey | YGDRUZYORMOVDN-MOICECLFSA-N |
| XLogP | 9.43 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.88 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |