C44H36N8 — CID 91082782
4-[10,15,20-tris(4-aminophenyl)-5,21,22,23-tetrahydroporphyrin-5-yl]aniline (PubChem CID 91082782) has the molecular formula C44H36N8 and a molecular weight of 676.83 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-aminophenyl)-5,21,22,23-tetrahydroporphyrin-5-yl]aniline.
| Compound Name | 4-[10,15,20-tris(4-aminophenyl)-5,21,22,23-tetrahydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 91082782 |
| Molecular Formula | C44H36N8 |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | 4-[10,15,20-tris(4-aminophenyl)-5,21,22,23-tetrahydroporphyrin-5-yl]aniline |
| SMILES | Nc1ccc(C2=C3C=CC(=N3)C(c3ccc(N)cc3)=c3ccc([nH]3)=C(c3ccc(N)cc3)c3ccc([nH]3)C(c3ccc(N)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H36N8/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27/h1-24,41,49-51H,45-48H2 |
| InChIKey | LDMRIPLUCXNVQB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|