C48H32N4O8 — CID 162272184
4-[10,15,20-tris(4-carboxyphenyl)-4,21,22,24-tetrahydroporphyrin-5-yl]benzoic acid (PubChem CID 162272184) has the molecular formula C48H32N4O8 and a molecular weight of 792.80 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-carboxyphenyl)-4,21,22,24-tetrahydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-carboxyphenyl)-4,21,22,24-tetrahydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 162272184 |
| Molecular Formula | C48H32N4O8 |
| Molecular Weight | 792.80 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 4-[10,15,20-tris(4-carboxyphenyl)-4,21,22,24-tetrahydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2=C3C=CC(=N3)C(c3ccc(C(=O)O)cc3)=c3ccc([nH]3)=C(c3ccc(C(=O)O)cc3)C3C=CC(=C(c4ccc(C(=O)O)cc4)c4ccc2[nH]4)N3)cc1 |
| InChI | InChI=1S/C48H32N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24,33,49-51H,(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | OWBDGJANZBXJRN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 205.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.80 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |