C62H64N4O4 — CID 163537824
4-[(5Z,10Z,14Z,19Z)-15-(4-carboxyphenyl)-10,20-bis[4-(2-ethylhexyl)phenyl]-1,2,21,23-tetrahydroporphyrin-5-yl]benzoic acid (PubChem CID 163537824) has the molecular formula C62H64N4O4 and a molecular weight of 929.22 g/mol. Its IUPAC name is 4-[(5Z,10Z,14Z,19Z)-15-(4-carboxyphenyl)-10,20-bis[4-(2-ethylhexyl)phenyl]-1,2,21,23-tetrahydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[(5Z,10Z,14Z,19Z)-15-(4-carboxyphenyl)-10,20-bis[4-(2-ethylhexyl)phenyl]-1,2,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 163537824 |
| Molecular Formula | C62H64N4O4 |
| Molecular Weight | 929.22 g/mol |
| Exact Mass | 928.49 |
| IUPAC Name | 4-[(5Z,10Z,14Z,19Z)-15-(4-carboxyphenyl)-10,20-bis[4-(2-ethylhexyl)phenyl]-1,2,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
| SMILES | CCCCC(CC)Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C(=O)O)cc3)=c3/cc/c([nH]3)=C(\c3ccc(CC(CC)CCCC)cc3)C3=N/C(=C(/c4ccc(C(=O)O)cc4)C4=CCC2N4)C=C3)cc1 |
| InChI | InChI=1S/C62H64N4O4/c1-5-9-11-39(7-3)37-41-13-17-43(18-14-41)57-49-29-33-53(63-49)59(45-21-25-47(26-22-45)61(67)68)55-35-31-51(65-55)58(44-19-15-42(16-20-44)38-40(8-4)12-10-6-2)52-32-36-56(66-52)60(54-34-30-50(57)64-54)46-23-27-48(28-24-46)62(69)70/h13-31,33-36,39-40,52,63,66H,5-12,32,37-38H2,1-4H3,(H,67,68)(H,69,70)/b57-49-,58-51-,59-53-,60-54- |
| InChIKey | DYNCRUGQLOPRIY-WHCMMYJFSA-N |
| XLogP | 12.43 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.22 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |