C48H66N6O6 — CID 150193409
2-[[4,6-bis[2-carboxy-4-(2-ethylhexyl)anilino]-1,3,5-triazin-2-yl]amino]-5-(2-ethylhexyl)benzoic acid (PubChem CID 150193409) has the molecular formula C48H66N6O6 and a molecular weight of 823.09 g/mol. Its IUPAC name is 2-[[4,6-bis[2-carboxy-4-(2-ethylhexyl)anilino]-1,3,5-triazin-2-yl]amino]-5-(2-ethylhexyl)benzoic acid.
| Compound Name | 2-[[4,6-bis[2-carboxy-4-(2-ethylhexyl)anilino]-1,3,5-triazin-2-yl]amino]-5-(2-ethylhexyl)benzoic acid |
|---|---|
| PubChem CID | 150193409 |
| Molecular Formula | C48H66N6O6 |
| Molecular Weight | 823.09 g/mol |
| Exact Mass | 822.50 |
| IUPAC Name | 2-[[4,6-bis[2-carboxy-4-(2-ethylhexyl)anilino]-1,3,5-triazin-2-yl]amino]-5-(2-ethylhexyl)benzoic acid |
| SMILES | CCCCC(CC)Cc1ccc(Nc2nc(Nc3ccc(CC(CC)CCCC)cc3C(=O)O)nc(Nc3ccc(CC(CC)CCCC)cc3C(=O)O)n2)c(C(=O)O)c1 |
| InChI | InChI=1S/C48H66N6O6/c1-7-13-16-31(10-4)25-34-19-22-40(37(28-34)43(55)56)49-46-52-47(50-41-23-20-35(29-38(41)44(57)58)26-32(11-5)17-14-8-2)54-48(53-46)51-42-24-21-36(30-39(42)45(59)60)27-33(12-6)18-15-9-3/h19-24,28-33H,7-18,25-27H2,1-6H3,(H,55,56)(H,57,58)(H,59,60)(H3,49,50,51,52,53,54) |
| InChIKey | FNXRAGKUEVOIMF-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.09 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |