C33H42N2O2 — CID 175286901
3,3-bis[2-cyano-4-(2-ethylhexyl)phenyl]prop-2-enoic acid (PubChem CID 175286901) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 3,3-bis[2-cyano-4-(2-ethylhexyl)phenyl]prop-2-enoic acid.
| Compound Name | 3,3-bis[2-cyano-4-(2-ethylhexyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175286901 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 3,3-bis[2-cyano-4-(2-ethylhexyl)phenyl]prop-2-enoic acid |
| SMILES | CCCCC(CC)Cc1ccc(C(=CC(=O)O)c2ccc(CC(CC)CCCC)cc2C#N)c(C#N)c1 |
| InChI | InChI=1S/C33H42N2O2/c1-5-9-11-24(7-3)17-26-13-15-30(28(19-26)22-34)32(21-33(36)37)31-16-14-27(20-29(31)23-35)18-25(8-4)12-10-6-2/h13-16,19-21,24-25H,5-12,17-18H2,1-4H3,(H,36,37) |
| InChIKey | RBGBHRGDKQHWBB-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|