C27H33NO3 — CID 141084834
2-cyano-3-[2-(2-ethylhexyl)-4-(2-methoxyethyl)phenyl]-3-phenylprop-2-enoic acid (PubChem CID 141084834) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-cyano-3-[2-(2-ethylhexyl)-4-(2-methoxyethyl)phenyl]-3-phenylprop-2-enoic acid.
| Compound Name | 2-cyano-3-[2-(2-ethylhexyl)-4-(2-methoxyethyl)phenyl]-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 141084834 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 2-cyano-3-[2-(2-ethylhexyl)-4-(2-methoxyethyl)phenyl]-3-phenylprop-2-enoic acid |
| SMILES | CCCCC(CC)Cc1cc(CCOC)ccc1C(=C(C#N)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H33NO3/c1-4-6-10-20(5-2)17-23-18-21(15-16-31-3)13-14-24(23)26(25(19-28)27(29)30)22-11-8-7-9-12-22/h7-9,11-14,18,20H,4-6,10,15-17H2,1-3H3,(H,29,30) |
| InChIKey | RQMFZRRPYJAQCJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|