C32H46O5 — CID 159550391
[2,3-bis(2-ethylhexyl)phenyl]-phenylmethanone;propanedioic acid (PubChem CID 159550391) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is [2,3-bis(2-ethylhexyl)phenyl]-phenylmethanone;propanedioic acid.
| Compound Name | [2,3-bis(2-ethylhexyl)phenyl]-phenylmethanone;propanedioic acid |
|---|---|
| PubChem CID | 159550391 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [2,3-bis(2-ethylhexyl)phenyl]-phenylmethanone;propanedioic acid |
| SMILES | CCCCC(CC)Cc1cccc(C(=O)c2ccccc2)c1CC(CC)CCCC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C29H42O.C3H4O4/c1-5-9-15-23(7-3)21-26-19-14-20-27(29(30)25-17-12-11-13-18-25)28(26)22-24(8-4)16-10-6-2;4-2(5)1-3(6)7/h11-14,17-20,23-24H,5-10,15-16,21-22H2,1-4H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | MFHWSWIOUABHAM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|