C17H19O3P — CID 174596350
(2,3-diethylphenyl)-phenylmethanone;phosphenous acid (PubChem CID 174596350) has the molecular formula C17H19O3P and a molecular weight of 302.31 g/mol. Its IUPAC name is (2,3-diethylphenyl)-phenylmethanone;phosphenous acid.
| Compound Name | (2,3-diethylphenyl)-phenylmethanone;phosphenous acid |
|---|---|
| PubChem CID | 174596350 |
| Molecular Formula | C17H19O3P |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2,3-diethylphenyl)-phenylmethanone;phosphenous acid |
| SMILES | CCc1cccc(C(=O)c2ccccc2)c1CC.O=PO |
| InChI | InChI=1S/C17H18O.HO2P/c1-3-13-11-8-12-16(15(13)4-2)17(18)14-9-6-5-7-10-14;1-3-2/h5-12H,3-4H2,1-2H3;(H,1,2) |
| InChIKey | AOKMRTGCBVSCMG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|