About diphenylmethanone;(2-ethylbenzoyl)phosphonic acid
diphenylmethanone;(2-ethylbenzoyl)phosphonic acid (PubChem CID 175203276) has the molecular formula C22H21O5P
and a molecular weight of 396.38 g/mol. Its IUPAC name is diphenylmethanone;(2-ethylbenzoyl)phosphonic acid.
Molecular Properties
| Compound Name | diphenylmethanone;(2-ethylbenzoyl)phosphonic acid |
| PubChem CID | 175203276 |
| Molecular Formula | C22H21O5P |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | diphenylmethanone;(2-ethylbenzoyl)phosphonic acid |
| SMILES | CCc1ccccc1C(=O)P(=O)(O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C9H11O4P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-7-5-3-4-6-8(7)9(10)14(11,12)13/h1-10H;3-6H,2H2,1H3,(H2,11,12,13) |
| InChIKey | HJZKVPNOFAAIAA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;(2-ethylbenzoyl)phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;(2-ethylbenzoyl)phosphonic acid?
The IUPAC name of diphenylmethanone;(2-ethylbenzoyl)phosphonic acid (CID 175203276) is diphenylmethanone;(2-ethylbenzoyl)phosphonic acid.
What is the SMILES notation for diphenylmethanone;(2-ethylbenzoyl)phosphonic acid?
The canonical SMILES for diphenylmethanone;(2-ethylbenzoyl)phosphonic acid is CCc1ccccc1C(=O)P(=O)(O)O.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;(2-ethylbenzoyl)phosphonic acid?
The InChIKey is HJZKVPNOFAAIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C9H11O4P/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-7-5-3-4-6-8(7)9(10)14(11,12)13/h1-10H;3-6H,2H2,1H3,(H2,11,12,13).
What are the key properties of diphenylmethanone;(2-ethylbenzoyl)phosphonic acid?
diphenylmethanone;(2-ethylbenzoyl)phosphonic acid has a molecular weight of 396.38 g/mol, XLogP of 4.48, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;(2-ethylbenzoyl)phosphonic acid is sourced from PubChem (CID 175203276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).