C31H54O3 — CID 174999561
2-(2-ethylhexoxy)-3,4-bis(2-ethylhexyl)benzoic acid (PubChem CID 174999561) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is 2-(2-ethylhexoxy)-3,4-bis(2-ethylhexyl)benzoic acid.
| Compound Name | 2-(2-ethylhexoxy)-3,4-bis(2-ethylhexyl)benzoic acid |
|---|---|
| PubChem CID | 174999561 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | 2-(2-ethylhexoxy)-3,4-bis(2-ethylhexyl)benzoic acid |
| SMILES | CCCCC(CC)COc1c(C(=O)O)ccc(CC(CC)CCCC)c1CC(CC)CCCC |
| InChI | InChI=1S/C31H54O3/c1-7-13-16-24(10-4)21-27-19-20-28(31(32)33)30(34-23-26(12-6)18-15-9-3)29(27)22-25(11-5)17-14-8-2/h19-20,24-26H,7-18,21-23H2,1-6H3,(H,32,33) |
| InChIKey | MLSRMHISGKBRSE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |