C60H92O16 — CID 175922587
3-(2-ethylhexyl)benzene-1,2,4,5-tetracarboxylic acid;tetraoctyl benzene-1,2,4,5-tetracarboxylate (PubChem CID 175922587) has the molecular formula C60H92O16 and a molecular weight of 1069.38 g/mol. Its IUPAC name is 3-(2-ethylhexyl)benzene-1,2,4,5-tetracarboxylic acid;tetraoctyl benzene-1,2,4,5-tetracarboxylate.
| Compound Name | 3-(2-ethylhexyl)benzene-1,2,4,5-tetracarboxylic acid;tetraoctyl benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 175922587 |
| Molecular Formula | C60H92O16 |
| Molecular Weight | 1069.38 g/mol |
| Exact Mass | 1068.64 |
| IUPAC Name | 3-(2-ethylhexyl)benzene-1,2,4,5-tetracarboxylic acid;tetraoctyl benzene-1,2,4,5-tetracarboxylate |
| SMILES | CCCCC(CC)Cc1c(C(=O)O)c(C(=O)O)cc(C(=O)O)c1C(=O)O.CCCCCCCCOC(=O)c1cc(C(=O)OCCCCCCCC)c(C(=O)OCCCCCCCC)cc1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C42H70O8.C18H22O8/c1-5-9-13-17-21-25-29-47-39(43)35-33-37(41(45)49-31-27-23-19-15-11-7-3)38(42(46)50-32-28-24-20-16-12-8-4)34-36(35)40(44)48-30-26-22-18-14-10-6-2;1-3-5-6-9(4-2)7-10-13(17(23)24)11(15(19)20)8-12(16(21)22)14(10)18(25)26/h33-34H,5-32H2,1-4H3;8-9H,3-7H2,1-2H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | NHTVMBGJTMROGW-UHFFFAOYSA-N |
| XLogP | 14.99 |
| TPSA | 254.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.38 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|