3,4-bis(2,4-diethyloctyl)phthalic acid

C32H54O4 — CID 66941254

IUPAC3,4-bis(2,4-diethyloctyl)phthalic acid
SMILESCCCCC(CC)CC(CC)Cc1ccc(C(=O)O)c(C(=O)O)c1CC(CC)CC(CC)CCCC
InChIInChI=1S/C32H54O4/c1-7-13-15-23(9-3)19-25(11-5)21-27-17-18-28(31(33)34)30(32(35)36)29(27)22-26(12-6)20-24(10-4)16-14-8-2/h17-18,23-26H,7-16,19-22H2,1-6H3,(H,33,34)(H,35,36)
InChIKeyVQOQQHFLZQEBOM-UHFFFAOYSA-N
MW502.78 g/mol
LogP9.43
Rot. Bonds20

About 3,4-bis(2,4-diethyloctyl)phthalic acid

3,4-bis(2,4-diethyloctyl)phthalic acid (PubChem CID 66941254) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is 3,4-bis(2,4-diethyloctyl)phthalic acid.

Molecular Properties

Compound Name3,4-bis(2,4-diethyloctyl)phthalic acid
PubChem CID66941254
Molecular FormulaC32H54O4
Molecular Weight502.78 g/mol
Exact Mass502.40
IUPAC Name3,4-bis(2,4-diethyloctyl)phthalic acid
SMILESCCCCC(CC)CC(CC)Cc1ccc(C(=O)O)c(C(=O)O)c1CC(CC)CC(CC)CCCC
InChIInChI=1S/C32H54O4/c1-7-13-15-23(9-3)19-25(11-5)21-27-17-18-28(31(33)34)30(32(35)36)29(27)22-26(12-6)20-24(10-4)16-14-8-2/h17-18,23-26H,7-16,19-22H2,1-6H3,(H,33,34)(H,35,36)
InChIKeyVQOQQHFLZQEBOM-UHFFFAOYSA-N
XLogP9.43
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds20
Heavy Atoms36
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500502.78
LogP ≤ 59.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,4-bis(2,4-diethyloctyl)phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-bis(2,4-diethyloctyl)phthalic acid?
The IUPAC name of 3,4-bis(2,4-diethyloctyl)phthalic acid (CID 66941254) is 3,4-bis(2,4-diethyloctyl)phthalic acid.
What is the SMILES notation for 3,4-bis(2,4-diethyloctyl)phthalic acid?
The canonical SMILES for 3,4-bis(2,4-diethyloctyl)phthalic acid is CCCCC(CC)CC(CC)Cc1ccc(C(=O)O)c(C(=O)O)c1CC(CC)CC(CC)CCCC.
What is the InChIKey of 3,4-bis(2,4-diethyloctyl)phthalic acid?
The InChIKey is VQOQQHFLZQEBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H54O4/c1-7-13-15-23(9-3)19-25(11-5)21-27-17-18-28(31(33)34)30(32(35)36)29(27)22-26(12-6)20-24(10-4)16-14-8-2/h17-18,23-26H,7-16,19-22H2,1-6H3,(H,33,34)(H,35,36).
What are the key properties of 3,4-bis(2,4-diethyloctyl)phthalic acid?
3,4-bis(2,4-diethyloctyl)phthalic acid has a molecular weight of 502.78 g/mol, XLogP of 9.43, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(2,4-diethyloctyl)phthalic acid is sourced from PubChem (CID 66941254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).