C24H36O4-2 — CID 22020305
2,4-bis(2-ethylhexyl)benzene-1,3-dicarboxylate (PubChem CID 22020305) has the molecular formula C24H36O4-2 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2,4-bis(2-ethylhexyl)benzene-1,3-dicarboxylate.
| Compound Name | 2,4-bis(2-ethylhexyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22020305 |
| Molecular Formula | C24H36O4-2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2,4-bis(2-ethylhexyl)benzene-1,3-dicarboxylate |
| SMILES | CCCCC(CC)Cc1ccc(C(=O)[O-])c(CC(CC)CCCC)c1C(=O)[O-] |
| InChI | InChI=1S/C24H38O4/c1-5-9-11-17(7-3)15-19-13-14-20(23(25)26)21(22(19)24(27)28)16-18(8-4)12-10-6-2/h13-14,17-18H,5-12,15-16H2,1-4H3,(H,25,26)(H,27,28)/p-2 |
| InChIKey | ZZCJQEFBOBFMPM-UHFFFAOYSA-L |
| XLogP | 3.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |