C32H54O8 — CID 121375739
2,4-bis[2-[2-(2-ethylhexoxy)ethoxy]ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 121375739) has the molecular formula C32H54O8 and a molecular weight of 566.78 g/mol. Its IUPAC name is 2,4-bis[2-[2-(2-ethylhexoxy)ethoxy]ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[2-[2-(2-ethylhexoxy)ethoxy]ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 121375739 |
| Molecular Formula | C32H54O8 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 2,4-bis[2-[2-(2-ethylhexoxy)ethoxy]ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | CCCCC(CC)COCCOCCc1ccc(C(=O)O)c(CCOCCOCC(CC)CCCC)c1C(=O)O |
| InChI | InChI=1S/C32H54O8/c1-5-9-11-25(7-3)23-39-21-19-37-17-15-27-13-14-29(31(33)34)28(30(27)32(35)36)16-18-38-20-22-40-24-26(8-4)12-10-6-2/h13-14,25-26H,5-12,15-24H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | DMPBVDIVKZISCP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|