C23H38O7 — CID 156631959
2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate (PubChem CID 156631959) has the molecular formula C23H38O7 and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate.
| Compound Name | 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 156631959 |
| Molecular Formula | C23H38O7 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-[2-[2-[2-(2-ethylhexoxy)ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate |
| SMILES | CCCCC(CC)COCCOCCOCCOCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H38O7/c1-3-5-6-20(4-2)19-29-16-15-27-12-11-26-13-14-28-17-18-30-23(25)21-7-9-22(24)10-8-21/h7-10,20,24H,3-6,11-19H2,1-2H3 |
| InChIKey | WBEUKKGMZWBAGU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|