C31H54O10 — CID 156631971
2-[2-[2-[2-[2-[2-[2-(2-propylheptoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate (PubChem CID 156631971) has the molecular formula C31H54O10 and a molecular weight of 586.76 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-propylheptoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-propylheptoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 156631971 |
| Molecular Formula | C31H54O10 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-propylheptoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-hydroxybenzoate |
| SMILES | CCCCCC(CCC)COCCOCCOCCOCCOCCOCCOCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H54O10/c1-3-5-6-8-28(7-4-2)27-40-24-23-38-20-19-36-16-15-34-13-14-35-17-18-37-21-22-39-25-26-41-31(33)29-9-11-30(32)12-10-29/h9-12,28,32H,3-8,13-27H2,1-2H3 |
| InChIKey | DVKFRMAPIVVTSI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|