C28H46O10 — CID 121375634
2,4-bis[2-(2-butoxy-2-ethoxyethoxy)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 121375634) has the molecular formula C28H46O10 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2,4-bis[2-(2-butoxy-2-ethoxyethoxy)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[2-(2-butoxy-2-ethoxyethoxy)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 121375634 |
| Molecular Formula | C28H46O10 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 2,4-bis[2-(2-butoxy-2-ethoxyethoxy)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | CCCCOC(COCCc1ccc(C(=O)O)c(CCOCC(OCC)OCCCC)c1C(=O)O)OCC |
| InChI | InChI=1S/C28H46O10/c1-5-9-15-37-24(35-7-3)19-33-17-13-21-11-12-23(27(29)30)22(26(21)28(31)32)14-18-34-20-25(36-8-4)38-16-10-6-2/h11-12,24-25H,5-10,13-20H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | DENUMXAPHCGPPF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|