C18H16O9 — CID 21265398
2-(2-ethoxyethyl)naphthalene-1,4,5,8-tetracarboxylic acid (PubChem CID 21265398) has the molecular formula C18H16O9 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)naphthalene-1,4,5,8-tetracarboxylic acid.
| Compound Name | 2-(2-ethoxyethyl)naphthalene-1,4,5,8-tetracarboxylic acid |
|---|---|
| PubChem CID | 21265398 |
| Molecular Formula | C18H16O9 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(2-ethoxyethyl)naphthalene-1,4,5,8-tetracarboxylic acid |
| SMILES | CCOCCc1cc(C(=O)O)c2c(C(=O)O)ccc(C(=O)O)c2c1C(=O)O |
| InChI | InChI=1S/C18H16O9/c1-2-27-6-5-8-7-11(17(23)24)13-9(15(19)20)3-4-10(16(21)22)14(13)12(8)18(25)26/h3-4,7H,2,5-6H2,1H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | BNGMBMDTJGRFAE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|