C14H10O7 — CID 130315879
8-(hydroxymethyl)naphthalene-1,4,5-tricarboxylic acid (PubChem CID 130315879) has the molecular formula C14H10O7 and a molecular weight of 290.23 g/mol. Its IUPAC name is 8-(hydroxymethyl)naphthalene-1,4,5-tricarboxylic acid.
| Compound Name | 8-(hydroxymethyl)naphthalene-1,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 130315879 |
| Molecular Formula | C14H10O7 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 8-(hydroxymethyl)naphthalene-1,4,5-tricarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c2c(C(=O)O)ccc(CO)c12 |
| InChI | InChI=1S/C14H10O7/c15-5-6-1-2-8(13(18)19)11-9(14(20)21)4-3-7(10(6)11)12(16)17/h1-4,15H,5H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | TZTAHZATZCKYAE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |