C32H20O8 — CID 175483573
2-(2-phenylethyl)perylene-3,4,9,10-tetracarboxylic acid (PubChem CID 175483573) has the molecular formula C32H20O8 and a molecular weight of 532.50 g/mol. Its IUPAC name is 2-(2-phenylethyl)perylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 2-(2-phenylethyl)perylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 175483573 |
| Molecular Formula | C32H20O8 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-(2-phenylethyl)perylene-3,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)c(CCc5ccccc5)cc(c5ccc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C32H20O8/c33-29(34)20-11-8-17-18-9-13-22(31(37)38)28-24(32(39)40)16(7-6-15-4-2-1-3-5-15)14-23(26(18)28)19-10-12-21(30(35)36)27(20)25(17)19/h1-5,8-14H,6-7H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | DSDUTXLLECURAP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|