C32H54O4 — CID 89482451
2,4-bis(10-methylundecyl)benzene-1,3-dicarboxylic acid (PubChem CID 89482451) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is 2,4-bis(10-methylundecyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis(10-methylundecyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 89482451 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | 2,4-bis(10-methylundecyl)benzene-1,3-dicarboxylic acid |
| SMILES | CC(C)CCCCCCCCCc1ccc(C(=O)O)c(CCCCCCCCCC(C)C)c1C(=O)O |
| InChI | InChI=1S/C32H54O4/c1-25(2)19-15-11-7-5-9-13-17-21-27-23-24-29(31(33)34)28(30(27)32(35)36)22-18-14-10-6-8-12-16-20-26(3)4/h23-26H,5-22H2,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | DHEFBKMSWKTUCE-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|