About 2-(5-methylhexyl)benzoic acid
2-(5-methylhexyl)benzoic acid (PubChem CID 122392323) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-(5-methylhexyl)benzoic acid.
Molecular Properties
| Compound Name | 2-(5-methylhexyl)benzoic acid |
| PubChem CID | 122392323 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-(5-methylhexyl)benzoic acid |
| SMILES | CC(C)CCCCc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H20O2/c1-11(2)7-3-4-8-12-9-5-6-10-13(12)14(15)16/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | LXKCMTAPAMHSTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methylhexyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylhexyl)benzoic acid?
The IUPAC name of 2-(5-methylhexyl)benzoic acid (CID 122392323) is 2-(5-methylhexyl)benzoic acid.
What is the SMILES notation for 2-(5-methylhexyl)benzoic acid?
The canonical SMILES for 2-(5-methylhexyl)benzoic acid is CC(C)CCCCc1ccccc1C(=O)O.
What is the InChIKey of 2-(5-methylhexyl)benzoic acid?
The InChIKey is LXKCMTAPAMHSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-11(2)7-3-4-8-12-9-5-6-10-13(12)14(15)16/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,15,16).
What are the key properties of 2-(5-methylhexyl)benzoic acid?
2-(5-methylhexyl)benzoic acid has a molecular weight of 220.31 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylhexyl)benzoic acid is sourced from PubChem (CID 122392323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).