C34H48O8 — CID 175853435
2-(7-methyloctoxycarbonyl)benzoic acid;3-(7-methyloctyl)phthalic acid (PubChem CID 175853435) has the molecular formula C34H48O8 and a molecular weight of 584.75 g/mol. Its IUPAC name is 2-(7-methyloctoxycarbonyl)benzoic acid;3-(7-methyloctyl)phthalic acid.
| Compound Name | 2-(7-methyloctoxycarbonyl)benzoic acid;3-(7-methyloctyl)phthalic acid |
|---|---|
| PubChem CID | 175853435 |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2-(7-methyloctoxycarbonyl)benzoic acid;3-(7-methyloctyl)phthalic acid |
| SMILES | CC(C)CCCCCCOC(=O)c1ccccc1C(=O)O.CC(C)CCCCCCc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/2C17H24O4/c1-13(2)9-5-3-4-8-12-21-17(20)15-11-7-6-10-14(15)16(18)19;1-12(2)8-5-3-4-6-9-13-10-7-11-14(16(18)19)15(13)17(20)21/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3,(H,18,19);7,10-12H,3-6,8-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | YUALRVVHZRPGDT-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|