C30H45NO4 — CID 174934045
aniline;2-octoxycarbonyl-6-octylbenzoic acid (PubChem CID 174934045) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is aniline;2-octoxycarbonyl-6-octylbenzoic acid.
| Compound Name | aniline;2-octoxycarbonyl-6-octylbenzoic acid |
|---|---|
| PubChem CID | 174934045 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | aniline;2-octoxycarbonyl-6-octylbenzoic acid |
| SMILES | CCCCCCCCOC(=O)c1cccc(CCCCCCCC)c1C(=O)O.Nc1ccccc1 |
| InChI | InChI=1S/C24H38O4.C6H7N/c1-3-5-7-9-11-13-16-20-17-15-18-21(22(20)23(25)26)24(27)28-19-14-12-10-8-6-4-2;7-6-4-2-1-3-5-6/h15,17-18H,3-14,16,19H2,1-2H3,(H,25,26);1-5H,7H2 |
| InChIKey | XYZOSBYGOAACCF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|