About deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid
deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid (PubChem CID 174502167) has the molecular formula C24H42N2O4
and a molecular weight of 423.62 g/mol. Its IUPAC name is deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid.
Molecular Properties
| Compound Name | deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid |
| PubChem CID | 174502167 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid |
| SMILES | CCCCCCCCOC(=O)c1c(CCCCCCCC)cccc1C(=O)O.[2H]NN |
| InChI | InChI=1S/C24H38O4.H4N2/c1-3-5-7-9-11-13-16-20-17-15-18-21(23(25)26)22(20)24(27)28-19-14-12-10-8-6-4-2;1-2/h15,17-18H,3-14,16,19H2,1-2H3,(H,25,26);1-2H2/i/hD |
| InChIKey | LEDBVYJWSFIEMA-DYCDLGHISA-N |
| XLogP | 5.62 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid?
The IUPAC name of deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid (CID 174502167) is deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid.
What is the SMILES notation for deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid?
The canonical SMILES for deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid is CCCCCCCCOC(=O)c1c(CCCCCCCC)cccc1C(=O)O.[2H]NN.
What is the InChIKey of deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid?
The InChIKey is LEDBVYJWSFIEMA-DYCDLGHISA-N. The full InChI is InChI=1S/C24H38O4.H4N2/c1-3-5-7-9-11-13-16-20-17-15-18-21(23(25)26)22(20)24(27)28-19-14-12-10-8-6-4-2;1-2/h15,17-18H,3-14,16,19H2,1-2H3,(H,25,26);1-2H2/i/hD.
What are the key properties of deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid?
deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid has a molecular weight of 423.62 g/mol, XLogP of 5.62, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriohydrazine;2-octoxycarbonyl-3-octylbenzoic acid is sourced from PubChem (CID 174502167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).