About 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene
2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene (PubChem CID 174298718) has the molecular formula C38H50O4
and a molecular weight of 570.81 g/mol. Its IUPAC name is 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene.
Molecular Properties
| Compound Name | 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene |
| PubChem CID | 174298718 |
| Molecular Formula | C38H50O4 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene |
| SMILES | C(=C\c1ccccc1)\c1ccccc1.CCCCCCCCOC(=O)c1c(CCCCCCCC)cccc1C(=O)O |
| InChI | InChI=1S/C24H38O4.C14H12/c1-3-5-7-9-11-13-16-20-17-15-18-21(23(25)26)22(20)24(27)28-19-14-12-10-8-6-4-2;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h15,17-18H,3-14,16,19H2,1-2H3,(H,25,26);1-12H/b;12-11- |
| InChIKey | QSWUEESNXZPTLI-LATCQUSVSA-N |
| XLogP | 10.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene?
The IUPAC name of 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene (CID 174298718) is 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene.
What is the SMILES notation for 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene?
The canonical SMILES for 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene is C(=C\c1ccccc1)\c1ccccc1.CCCCCCCCOC(=O)c1c(CCCCCCCC)cccc1C(=O)O.
What is the InChIKey of 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene?
The InChIKey is QSWUEESNXZPTLI-LATCQUSVSA-N. The full InChI is InChI=1S/C24H38O4.C14H12/c1-3-5-7-9-11-13-16-20-17-15-18-21(23(25)26)22(20)24(27)28-19-14-12-10-8-6-4-2;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h15,17-18H,3-14,16,19H2,1-2H3,(H,25,26);1-12H/b;12-11-.
What are the key properties of 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene?
2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene has a molecular weight of 570.81 g/mol, XLogP of 10.66, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxycarbonyl-3-octylbenzoic acid;(Z)-stilbene is sourced from PubChem (CID 174298718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).