C20H30O8 — CID 101322093
2,4-bis[4-(2-hydroxyethoxy)butyl]benzene-1,3-dicarboxylic acid (PubChem CID 101322093) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is 2,4-bis[4-(2-hydroxyethoxy)butyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[4-(2-hydroxyethoxy)butyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322093 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2,4-bis[4-(2-hydroxyethoxy)butyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(CCCCOCCO)c(C(=O)O)c1CCCCOCCO |
| InChI | InChI=1S/C20H30O8/c21-9-13-27-11-3-1-5-15-7-8-17(19(23)24)16(18(15)20(25)26)6-2-4-12-28-14-10-22/h7-8,21-22H,1-6,9-14H2,(H,23,24)(H,25,26) |
| InChIKey | IWTXTHJZRNBEKU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|