C18H26O12 — CID 101322073
2,4-bis[2-(hydroxymethoxy)ethoxymethoxymethyl]benzene-1,3-dicarboxylic acid (PubChem CID 101322073) has the molecular formula C18H26O12 and a molecular weight of 434.39 g/mol. Its IUPAC name is 2,4-bis[2-(hydroxymethoxy)ethoxymethoxymethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis[2-(hydroxymethoxy)ethoxymethoxymethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322073 |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2,4-bis[2-(hydroxymethoxy)ethoxymethoxymethyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(COCOCCOCO)c(C(=O)O)c1COCOCCOCO |
| InChI | InChI=1S/C18H26O12/c19-9-25-3-5-27-11-29-7-13-1-2-14(17(21)22)15(16(13)18(23)24)8-30-12-28-6-4-26-10-20/h1-2,19-20H,3-12H2,(H,21,22)(H,23,24) |
| InChIKey | TYVJJHCFEAKDSD-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|