C20H30O14 — CID 101322207
4,5-bis(2-hydroxyethoxymethoxymethoxymethoxymethyl)benzene-1,3-dicarboxylic acid (PubChem CID 101322207) has the molecular formula C20H30O14 and a molecular weight of 494.45 g/mol. Its IUPAC name is 4,5-bis(2-hydroxyethoxymethoxymethoxymethoxymethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,5-bis(2-hydroxyethoxymethoxymethoxymethoxymethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322207 |
| Molecular Formula | C20H30O14 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4,5-bis(2-hydroxyethoxymethoxymethoxymethoxymethyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(COCOCOCOCCO)c(COCOCOCOCCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H30O14/c21-1-3-27-9-31-13-33-11-29-7-16-5-15(19(23)24)6-17(20(25)26)18(16)8-30-12-34-14-32-10-28-4-2-22/h5-6,21-22H,1-4,7-14H2,(H,23,24)(H,25,26) |
| InChIKey | BMSOLZPNHKTCBQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 188.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|