C14H18O8 — CID 101321980
2,5-bis[2-(hydroxymethoxy)ethyl]benzene-1,3-dicarboxylic acid (PubChem CID 101321980) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 2,5-bis[2-(hydroxymethoxy)ethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,5-bis[2-(hydroxymethoxy)ethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101321980 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2,5-bis[2-(hydroxymethoxy)ethyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(CCOCO)cc(C(=O)O)c1CCOCO |
| InChI | InChI=1S/C14H18O8/c15-7-21-3-1-9-5-11(13(17)18)10(2-4-22-8-16)12(6-9)14(19)20/h5-6,15-16H,1-4,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | FQOWGDINAKHSDE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|