C18H18O4 — CID 175316956
2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid (PubChem CID 175316956) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175316956 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid |
| SMILES | CCc1c(C(=O)O)cc(CCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C18H18O4/c1-2-14-15(17(19)20)10-13(11-16(14)18(21)22)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YUXVENUWMYOAEH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |