2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid

C18H18O4 — CID 175316956

IUPAC2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid
SMILESCCc1c(C(=O)O)cc(CCc2ccccc2)cc1C(=O)O
InChIInChI=1S/C18H18O4/c1-2-14-15(17(19)20)10-13(11-16(14)18(21)22)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,19,20)(H,21,22)
InChIKeyYUXVENUWMYOAEH-UHFFFAOYSA-N
MW298.34 g/mol
LogP3.43
Rot. Bonds6

About 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid

2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid (PubChem CID 175316956) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid
PubChem CID175316956
Molecular FormulaC18H18O4
Molecular Weight298.34 g/mol
Exact Mass298.12
IUPAC Name2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid
SMILESCCc1c(C(=O)O)cc(CCc2ccccc2)cc1C(=O)O
InChIInChI=1S/C18H18O4/c1-2-14-15(17(19)20)10-13(11-16(14)18(21)22)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,19,20)(H,21,22)
InChIKeyYUXVENUWMYOAEH-UHFFFAOYSA-N
XLogP3.43
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 53.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid?
The IUPAC name of 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid (CID 175316956) is 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid is CCc1c(C(=O)O)cc(CCc2ccccc2)cc1C(=O)O.
What is the InChIKey of 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid?
The InChIKey is YUXVENUWMYOAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-2-14-15(17(19)20)10-13(11-16(14)18(21)22)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,19,20)(H,21,22).
What are the key properties of 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid?
2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid has a molecular weight of 298.34 g/mol, XLogP of 3.43, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(2-phenylethyl)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 175316956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).