C20H30O10 — CID 101322142
2,5-bis[2-(3-hydroxypropoxy)ethoxymethyl]benzene-1,3-dicarboxylic acid (PubChem CID 101322142) has the molecular formula C20H30O10 and a molecular weight of 430.45 g/mol. Its IUPAC name is 2,5-bis[2-(3-hydroxypropoxy)ethoxymethyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2,5-bis[2-(3-hydroxypropoxy)ethoxymethyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 101322142 |
| Molecular Formula | C20H30O10 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2,5-bis[2-(3-hydroxypropoxy)ethoxymethyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(COCCOCCCO)cc(C(=O)O)c1COCCOCCCO |
| InChI | InChI=1S/C20H30O10/c21-3-1-5-27-7-9-29-13-15-11-16(19(23)24)18(17(12-15)20(25)26)14-30-10-8-28-6-2-4-22/h11-12,21-22H,1-10,13-14H2,(H,23,24)(H,25,26) |
| InChIKey | DQIVDISEHWRENA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|