C36H62O10 — CID 121375623
3,4-bis[2-(2-ethoxy-2-hexoxyethoxy)butyl]phthalic acid (PubChem CID 121375623) has the molecular formula C36H62O10 and a molecular weight of 654.88 g/mol. Its IUPAC name is 3,4-bis[2-(2-ethoxy-2-hexoxyethoxy)butyl]phthalic acid.
| Compound Name | 3,4-bis[2-(2-ethoxy-2-hexoxyethoxy)butyl]phthalic acid |
|---|---|
| PubChem CID | 121375623 |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | 3,4-bis[2-(2-ethoxy-2-hexoxyethoxy)butyl]phthalic acid |
| SMILES | CCCCCCOC(COC(CC)Cc1ccc(C(=O)O)c(C(=O)O)c1CC(CC)OCC(OCC)OCCCCCC)OCC |
| InChI | InChI=1S/C36H62O10/c1-7-13-15-17-21-43-32(41-11-5)25-45-28(9-3)23-27-19-20-30(35(37)38)34(36(39)40)31(27)24-29(10-4)46-26-33(42-12-6)44-22-18-16-14-8-2/h19-20,28-29,32-33H,7-18,21-26H2,1-6H3,(H,37,38)(H,39,40) |
| InChIKey | ACWYXLQXNJBCIT-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|