C23H30O3 — CID 67924694
5-(3-benzylnonyl)-2-hydroxybenzoic acid (PubChem CID 67924694) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 5-(3-benzylnonyl)-2-hydroxybenzoic acid.
| Compound Name | 5-(3-benzylnonyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 67924694 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 5-(3-benzylnonyl)-2-hydroxybenzoic acid |
| SMILES | CCCCCCC(CCc1ccc(O)c(C(=O)O)c1)Cc1ccccc1 |
| InChI | InChI=1S/C23H30O3/c1-2-3-4-6-11-19(16-18-9-7-5-8-10-18)12-13-20-14-15-22(24)21(17-20)23(25)26/h5,7-10,14-15,17,19,24H,2-4,6,11-13,16H2,1H3,(H,25,26) |
| InChIKey | REPDEPBIANUYFI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|