C48H32N4O8 — CID 24870818
4-[(5Z,10Z,14Z,19Z)-10,15,20-tris(4-carboxyphenyl)-1,4,21,23-tetrahydroporphyrin-5-yl]benzoic acid (PubChem CID 24870818) has the molecular formula C48H32N4O8 and a molecular weight of 792.80 g/mol. Its IUPAC name is 4-[(5Z,10Z,14Z,19Z)-10,15,20-tris(4-carboxyphenyl)-1,4,21,23-tetrahydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[(5Z,10Z,14Z,19Z)-10,15,20-tris(4-carboxyphenyl)-1,4,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 24870818 |
| Molecular Formula | C48H32N4O8 |
| Molecular Weight | 792.80 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 4-[(5Z,10Z,14Z,19Z)-10,15,20-tris(4-carboxyphenyl)-1,4,21,23-tetrahydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C(=O)O)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C(=O)O)cc3)C3=N/C(=C(/c4ccc(C(=O)O)cc4)C4C=CC2N4)C=C3)cc1 |
| InChI | InChI=1S/C48H32N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24,33,35,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60)/b41-34-,42-37-,43-38-,44-40- |
| InChIKey | HTGGASOZKHPXGS-XSWNCLSXSA-N |
| XLogP | 5.96 |
| TPSA | 201.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|