C48H38N4O — CID 135472049
2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-24-ol (PubChem CID 135472049) has the molecular formula C48H38N4O and a molecular weight of 686.86 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-24-ol.
| Compound Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-24-ol |
|---|---|
| PubChem CID | 135472049 |
| Molecular Formula | C48H38N4O |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | 2,7,12,17-tetrakis(4-methylphenyl)-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaen-24-ol |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=c3/cc/c([nH]3)=C(\c3ccc(C)cc3)C3=N/C(=C(/c4ccc(C)cc4)C4=NC=C2C4O)C=C3)cc1 |
| InChI | InChI=1S/C48H38N4O/c1-28-5-13-32(14-6-28)43-36-27-49-47(48(36)53)46(35-19-11-31(4)12-20-35)42-26-25-41(52-42)45(34-17-9-30(3)10-18-34)40-24-23-39(51-40)44(38-22-21-37(43)50-38)33-15-7-29(2)8-16-33/h5-27,48,51,53H,1-4H3/b43-36-,43-37-,44-38-,44-39-,45-40-,45-41-,46-42-,47-46+ |
| InChIKey | ZQKUJCSOWOZZAM-DXXWIJSKSA-N |
| XLogP | 8.20 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |