C44H30N6 — CID 70297532
5,15-bis(4-methylphenyl)-10,20-dipyridin-4-ylporphyrin (PubChem CID 70297532) has the molecular formula C44H30N6 and a molecular weight of 642.77 g/mol. Its IUPAC name is 5,15-bis(4-methylphenyl)-10,20-dipyridin-4-ylporphyrin.
| Compound Name | 5,15-bis(4-methylphenyl)-10,20-dipyridin-4-ylporphyrin |
|---|---|
| PubChem CID | 70297532 |
| Molecular Formula | C44H30N6 |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 5,15-bis(4-methylphenyl)-10,20-dipyridin-4-ylporphyrin |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccncc3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3ccncc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C44H30N6/c1-27-3-7-29(8-4-27)41-33-11-15-37(47-33)43(31-19-23-45-24-20-31)39-17-13-35(49-39)42(30-9-5-28(2)6-10-30)36-14-18-40(50-36)44(32-21-25-46-26-22-32)38-16-12-34(41)48-38/h3-26H,1-2H3/b41-33-,41-34-,42-35-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | ZQCBTSIMSJWDNY-VRDUDMDPSA-N |
| XLogP | 9.10 |
| TPSA | 75.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |