C56H41F5N4 — CID 87231870
5,15-bis(4-methylphenyl)-10-(2,3,4,5,6-pentafluorophenyl)-20-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]porphyrin (PubChem CID 87231870) has the molecular formula C56H41F5N4 and a molecular weight of 864.96 g/mol. Its IUPAC name is 5,15-bis(4-methylphenyl)-10-(2,3,4,5,6-pentafluorophenyl)-20-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]porphyrin.
| Compound Name | 5,15-bis(4-methylphenyl)-10-(2,3,4,5,6-pentafluorophenyl)-20-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]porphyrin |
|---|---|
| PubChem CID | 87231870 |
| Molecular Formula | C56H41F5N4 |
| Molecular Weight | 864.96 g/mol |
| Exact Mass | 864.33 |
| IUPAC Name | 5,15-bis(4-methylphenyl)-10-(2,3,4,5,6-pentafluorophenyl)-20-[4-(4-prop-2-enylhepta-1,6-dien-4-yl)phenyl]porphyrin |
| SMILES | C=CCC(CC=C)(CC=C)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3c(F)c(F)c(F)c(F)c3F)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C56H41F5N4/c1-6-29-56(30-7-2,31-8-3)37-19-17-36(18-20-37)48-40-23-21-38(62-40)46(34-13-9-32(4)10-14-34)42-25-27-44(64-42)49(50-51(57)53(59)55(61)54(60)52(50)58)45-28-26-43(65-45)47(39-22-24-41(48)63-39)35-15-11-33(5)12-16-35/h6-28H,1-3,29-31H2,4-5H3/b46-38-,46-42-,47-39-,47-43-,48-40-,48-41-,49-44+,49-45+ |
| InChIKey | XHVZCLKSVXKZSA-YKEBKZFASA-N |
| XLogP | 13.97 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.96 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|