C48H37ClFeN4O4 — CID 90198679
iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin;hydrochloride (PubChem CID 90198679) has the molecular formula C48H37ClFeN4O4 and a molecular weight of 825.15 g/mol. Its IUPAC name is iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin;hydrochloride.
| Compound Name | iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin;hydrochloride |
|---|---|
| PubChem CID | 90198679 |
| Molecular Formula | C48H37ClFeN4O4 |
| Molecular Weight | 825.15 g/mol |
| Exact Mass | 824.19 |
| IUPAC Name | iron;5,10,15,20-tetrakis(4-methoxyphenyl)porphyrin;hydrochloride |
| SMILES | COc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(OC)cc3)=C3/C=CC(=N3)/C(c3ccc(OC)cc3)=C3/C=CC(=N3)/C(c3ccc(OC)cc3)=C3/C=CC2=N3)cc1.Cl.[Fe] |
| InChI | InChI=1S/C48H36N4O4.ClH.Fe/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;;/h5-28H,1-4H3;1H;/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-;; |
| InChIKey | KKSIIJHPJMQDAZ-HTMHXADGSA-N |
| XLogP | 10.14 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.15 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|