C42H32N2O3S2 — CID 177441942
(2Z,6Z,11Z,17Z)-2,7,12-tris(4-methoxyphenyl)-22,23-dithia-24,25-diazapentacyclo[17.2.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene (PubChem CID 177441942) has the molecular formula C42H32N2O3S2 and a molecular weight of 676.86 g/mol. Its IUPAC name is (2Z,6Z,11Z,17Z)-2,7,12-tris(4-methoxyphenyl)-22,23-dithia-24,25-diazapentacyclo[17.2.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene.
| Compound Name | (2Z,6Z,11Z,17Z)-2,7,12-tris(4-methoxyphenyl)-22,23-dithia-24,25-diazapentacyclo[17.2.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene |
|---|---|
| PubChem CID | 177441942 |
| Molecular Formula | C42H32N2O3S2 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | (2Z,6Z,11Z,17Z)-2,7,12-tris(4-methoxyphenyl)-22,23-dithia-24,25-diazapentacyclo[17.2.1.13,6.18,11.113,16]pentacosa-1(21),2,4,6,8(24),9,11,13,15,17,19-undecaene |
| SMILES | COc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(OC)cc3)=c3/cc/c([nH]3)=C(\c3ccc(OC)cc3)c3ccc(s3)/C=C\c3ccc2s3)cc1 |
| InChI | InChI=1S/C42H32N2O3S2/c1-45-29-10-4-26(5-11-29)40-34-20-22-36(43-34)41(27-6-12-30(46-2)13-7-27)38-24-18-32(48-38)16-17-33-19-25-39(49-33)42(37-23-21-35(40)44-37)28-8-14-31(47-3)15-9-28/h4-25,43H,1-3H3/b17-16-,32-16+,33-17-,40-34-,40-35-,41-36-,41-38+,42-37-,42-39- |
| InChIKey | NRHWEMAKMWBHOO-VIOSGTGYSA-N |
| XLogP | 8.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |