C50H29Cl4N3 — CID 135424566
2,7,12,17-tetrakis(4-chlorophenyl)-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene (PubChem CID 135424566) has the molecular formula C50H29Cl4N3 and a molecular weight of 813.62 g/mol. Its IUPAC name is 2,7,12,17-tetrakis(4-chlorophenyl)-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene.
| Compound Name | 2,7,12,17-tetrakis(4-chlorophenyl)-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene |
|---|---|
| PubChem CID | 135424566 |
| Molecular Formula | C50H29Cl4N3 |
| Molecular Weight | 813.62 g/mol |
| Exact Mass | 811.11 |
| IUPAC Name | 2,7,12,17-tetrakis(4-chlorophenyl)-27,28,29-triazahexacyclo[16.7.1.13,6.18,11.113,16.019,25]nonacosa-1(26),2,4,6(29),7,9,11,13(27),14,16,18,20,22,24-tetradecaene |
| SMILES | Clc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(Cl)cc3)=c3/cc/c([nH]3)=C(\c3ccc(Cl)cc3)C3=N/C(=C(/c4ccc(Cl)cc4)c4cc2c2cccccc4-2)C=C3)cc1 |
| InChI | InChI=1S/C50H29Cl4N3/c51-33-14-6-29(7-15-33)47-39-28-40(38-5-3-1-2-4-37(38)39)48(30-8-16-34(52)17-9-30)42-23-25-44(56-42)50(32-12-20-36(54)21-13-32)46-27-26-45(57-46)49(43-24-22-41(47)55-43)31-10-18-35(53)19-11-31/h1-28,57H/b47-41-,48-42-,49-45-,50-46- |
| InChIKey | RHSILSQMGSOIOU-HTMIEPNNSA-N |
| XLogP | 12.39 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.62 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |